C21H26N4O3S — CID 2040138
(8aS,9R)-9-(3-ethoxy-4-hydroxyphenyl)-2-ethylsulfanyl-6,6-dimethyl-4,7,8a,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 2040138) has the molecular formula C21H26N4O3S and a molecular weight of 414.53 g/mol. Its IUPAC name is (8aS,9R)-9-(3-ethoxy-4-hydroxyphenyl)-2-ethylsulfanyl-6,6-dimethyl-4,7,8a,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | (8aS,9R)-9-(3-ethoxy-4-hydroxyphenyl)-2-ethylsulfanyl-6,6-dimethyl-4,7,8a,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 2040138 |
| Molecular Formula | C21H26N4O3S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | (8aS,9R)-9-(3-ethoxy-4-hydroxyphenyl)-2-ethylsulfanyl-6,6-dimethyl-4,7,8a,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | CCOc1cc([C@H]2[C@@H]3C(=O)CC(C)(C)C=C3Nc3nc(SCC)nn32)ccc1O |
| InChI | InChI=1S/C21H26N4O3S/c1-5-28-16-9-12(7-8-14(16)26)18-17-13(10-21(3,4)11-15(17)27)22-19-23-20(29-6-2)24-25(18)19/h7-10,17-18,26H,5-6,11H2,1-4H3,(H,22,23,24)/t17-,18-/m0/s1 |
| InChIKey | AHOOYAGPZLTQPB-ROUUACIJSA-N |
| XLogP | 4.01 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |