C25H30N2O3 — CID 3295131
6-(3-ethoxy-4-hydroxyphenyl)-2,3,9,9-tetramethyl-6,6a,8,11-tetrahydro-5H-benzo[b][1,4]benzodiazepin-7-one (PubChem CID 3295131) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is 6-(3-ethoxy-4-hydroxyphenyl)-2,3,9,9-tetramethyl-6,6a,8,11-tetrahydro-5H-benzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 6-(3-ethoxy-4-hydroxyphenyl)-2,3,9,9-tetramethyl-6,6a,8,11-tetrahydro-5H-benzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 3295131 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | 6-(3-ethoxy-4-hydroxyphenyl)-2,3,9,9-tetramethyl-6,6a,8,11-tetrahydro-5H-benzo[b][1,4]benzodiazepin-7-one |
| SMILES | CCOc1cc(C2Nc3cc(C)c(C)cc3NC3=CC(C)(C)CC(=O)C32)ccc1O |
| InChI | InChI=1S/C25H30N2O3/c1-6-30-22-11-16(7-8-20(22)28)24-23-19(12-25(4,5)13-21(23)29)26-17-9-14(2)15(3)10-18(17)27-24/h7-12,23-24,26-28H,6,13H2,1-5H3 |
| InChIKey | UOVCPIUFWGWBJG-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |