C9H7N3 — CID 20455
1H-Benzimidazole-2-acetonitrile (PubChem CID 20455) has the molecular formula C9H7N3 and a molecular weight of 157.17 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)acetonitrile.
| Compound Name | 1H-Benzimidazole-2-acetonitrile |
|---|---|
| PubChem CID | 20455 |
| Molecular Formula | C9H7N3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.06 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)acetonitrile |
| SMILES | C1=CC=C2C(=C1)NC(=N2)CC#N |
| InChIKey | BWOVACANEIVHST-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 52.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | 205 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |