C18H24N2O2S — CID 2047582
(2R)-1-(2-methoxyethyl)-7,7-dimethyl-2-phenyl-2,3,5,8-tetrahydropyrano[4,3-d]pyrimidine-4-thione (PubChem CID 2047582) has the molecular formula C18H24N2O2S and a molecular weight of 332.47 g/mol. Its IUPAC name is (2R)-1-(2-methoxyethyl)-7,7-dimethyl-2-phenyl-2,3,5,8-tetrahydropyrano[4,3-d]pyrimidine-4-thione.
| Compound Name | (2R)-1-(2-methoxyethyl)-7,7-dimethyl-2-phenyl-2,3,5,8-tetrahydropyrano[4,3-d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 2047582 |
| Molecular Formula | C18H24N2O2S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | (2R)-1-(2-methoxyethyl)-7,7-dimethyl-2-phenyl-2,3,5,8-tetrahydropyrano[4,3-d]pyrimidine-4-thione |
| SMILES | COCCN1C2=C(COC(C)(C)C2)C(=S)N[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H24N2O2S/c1-18(2)11-15-14(12-22-18)17(23)19-16(20(15)9-10-21-3)13-7-5-4-6-8-13/h4-8,16H,9-12H2,1-3H3,(H,19,23)/t16-/m1/s1 |
| InChIKey | KNCXBUXQXDXGCX-MRXNPFEDSA-N |
| XLogP | 3.02 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|