C20H27N2O2S+ — CID 2048705
(2S)-7,7-dimethyl-1-[[(2R)-oxolan-2-yl]methyl]-2-phenyl-2,3,5,8-tetrahydro-1H-pyrano[4,3-d]pyrimidin-1-ium-4-thione (PubChem CID 2048705) has the molecular formula C20H27N2O2S+ and a molecular weight of 359.52 g/mol. Its IUPAC name is (2S)-7,7-dimethyl-1-[[(2R)-oxolan-2-yl]methyl]-2-phenyl-2,3,5,8-tetrahydro-1H-pyrano[4,3-d]pyrimidin-1-ium-4-thione.
| Compound Name | (2S)-7,7-dimethyl-1-[[(2R)-oxolan-2-yl]methyl]-2-phenyl-2,3,5,8-tetrahydro-1H-pyrano[4,3-d]pyrimidin-1-ium-4-thione |
|---|---|
| PubChem CID | 2048705 |
| Molecular Formula | C20H27N2O2S+ |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | (2S)-7,7-dimethyl-1-[[(2R)-oxolan-2-yl]methyl]-2-phenyl-2,3,5,8-tetrahydro-1H-pyrano[4,3-d]pyrimidin-1-ium-4-thione |
| SMILES | CC1(C)CC2=C(CO1)C(=S)N[C@H](c1ccccc1)[NH+]2C[C@H]1CCCO1 |
| InChI | InChI=1S/C20H26N2O2S/c1-20(2)11-17-16(13-24-20)19(25)21-18(14-7-4-3-5-8-14)22(17)12-15-9-6-10-23-15/h3-5,7-8,15,18H,6,9-13H2,1-2H3,(H,21,25)/p+1/t15-,18+/m1/s1 |
| InChIKey | PYWQZNPFVSSDSM-QAPCUYQASA-O |
| XLogP | 2.13 |
| TPSA | 34.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|