C19H24N2OS — CID 2047551
(2R)-1-[[(2S)-oxolan-2-yl]methyl]-2-phenyl-2,3,5,6,7,8-hexahydroquinazoline-4-thione (PubChem CID 2047551) has the molecular formula C19H24N2OS and a molecular weight of 328.48 g/mol. Its IUPAC name is (2R)-1-[[(2S)-oxolan-2-yl]methyl]-2-phenyl-2,3,5,6,7,8-hexahydroquinazoline-4-thione.
| Compound Name | (2R)-1-[[(2S)-oxolan-2-yl]methyl]-2-phenyl-2,3,5,6,7,8-hexahydroquinazoline-4-thione |
|---|---|
| PubChem CID | 2047551 |
| Molecular Formula | C19H24N2OS |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | (2R)-1-[[(2S)-oxolan-2-yl]methyl]-2-phenyl-2,3,5,6,7,8-hexahydroquinazoline-4-thione |
| SMILES | S=C1N[C@@H](c2ccccc2)N(C[C@@H]2CCCO2)C2=C1CCCC2 |
| InChI | InChI=1S/C19H24N2OS/c23-19-16-10-4-5-11-17(16)21(13-15-9-6-12-22-15)18(20-19)14-7-2-1-3-8-14/h1-3,7-8,15,18H,4-6,9-13H2,(H,20,23)/t15-,18+/m0/s1 |
| InChIKey | RXVQOODXQFDNAH-MAUKXSAKSA-N |
| XLogP | 3.92 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|