C16H21N2O3+ — CID 2049383
(1S)-1-(3,4,5-trimethoxyphenyl)-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazin-2-ium (PubChem CID 2049383) has the molecular formula C16H21N2O3+ and a molecular weight of 289.36 g/mol. Its IUPAC name is (1S)-1-(3,4,5-trimethoxyphenyl)-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazin-2-ium.
| Compound Name | (1S)-1-(3,4,5-trimethoxyphenyl)-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazin-2-ium |
|---|---|
| PubChem CID | 2049383 |
| Molecular Formula | C16H21N2O3+ |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | (1S)-1-(3,4,5-trimethoxyphenyl)-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazin-2-ium |
| SMILES | COc1cc([C@@H]2[NH2+]CCn3cccc32)cc(OC)c1OC |
| InChI | InChI=1S/C16H20N2O3/c1-19-13-9-11(10-14(20-2)16(13)21-3)15-12-5-4-7-18(12)8-6-17-15/h4-5,7,9-10,15,17H,6,8H2,1-3H3/p+1/t15-/m0/s1 |
| InChIKey | LCMFCXIQZPMJCR-HNNXBMFYSA-O |
| XLogP | 1.18 |
| TPSA | 49.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |