C13H15N2+ — CID 6939225
(1R)-1-phenyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazin-2-ium (PubChem CID 6939225) has the molecular formula C13H15N2+ and a molecular weight of 199.28 g/mol. Its IUPAC name is (1R)-1-phenyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazin-2-ium.
| Compound Name | (1R)-1-phenyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazin-2-ium |
|---|---|
| PubChem CID | 6939225 |
| Molecular Formula | C13H15N2+ |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | (1R)-1-phenyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazin-2-ium |
| SMILES | c1ccc([C@H]2[NH2+]CCn3cccc32)cc1 |
| InChI | InChI=1S/C13H14N2/c1-2-5-11(6-3-1)13-12-7-4-9-15(12)10-8-14-13/h1-7,9,13-14H,8,10H2/p+1/t13-/m1/s1 |
| InChIKey | OJWIBJCTTSRXTB-CYBMUJFWSA-O |
| XLogP | 1.15 |
| TPSA | 21.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |