C12H24S3 — CID 20502921
2-[3,4-bis(2-sulfanylethyl)cyclohexyl]ethanethiol (PubChem CID 20502921) has the molecular formula C12H24S3 and a molecular weight of 264.52 g/mol. Its IUPAC name is 2-[3,4-bis(2-sulfanylethyl)cyclohexyl]ethanethiol.
| Compound Name | 2-[3,4-bis(2-sulfanylethyl)cyclohexyl]ethanethiol |
|---|---|
| PubChem CID | 20502921 |
| Molecular Formula | C12H24S3 |
| Molecular Weight | 264.52 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 2-[3,4-bis(2-sulfanylethyl)cyclohexyl]ethanethiol |
| SMILES | SCCC1CCC(CCS)C(CCS)C1 |
| InChI | InChI=1S/C12H24S3/c13-6-3-10-1-2-11(4-7-14)12(9-10)5-8-15/h10-15H,1-9H2 |
| InChIKey | OBEAYGIWBMQVKN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|