C13H14BrN3O2 — CID 20504006
4-(bromomethyl)-5-[4-(dimethylamino)benzoyl]-1,3-dihydroimidazol-2-one (PubChem CID 20504006) has the molecular formula C13H14BrN3O2 and a molecular weight of 324.18 g/mol. Its IUPAC name is 4-(bromomethyl)-5-[4-(dimethylamino)benzoyl]-1,3-dihydroimidazol-2-one.
| Compound Name | 4-(bromomethyl)-5-[4-(dimethylamino)benzoyl]-1,3-dihydroimidazol-2-one |
|---|---|
| PubChem CID | 20504006 |
| Molecular Formula | C13H14BrN3O2 |
| Molecular Weight | 324.18 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 4-(bromomethyl)-5-[4-(dimethylamino)benzoyl]-1,3-dihydroimidazol-2-one |
| SMILES | CN(C)c1ccc(C(=O)c2[nH]c(=O)[nH]c2CBr)cc1 |
| InChI | InChI=1S/C13H14BrN3O2/c1-17(2)9-5-3-8(4-6-9)12(18)11-10(7-14)15-13(19)16-11/h3-6H,7H2,1-2H3,(H2,15,16,19) |
| InChIKey | ZEXSBOWPLVHQEF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 68.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.18 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|