C20H15N3O4 — CID 10570568
2-[4-(5-ethyl-2-oxo-1,3-dihydroimidazole-4-carbonyl)phenyl]isoindole-1,3-dione (PubChem CID 10570568) has the molecular formula C20H15N3O4 and a molecular weight of 361.36 g/mol. Its IUPAC name is 2-[4-(5-ethyl-2-oxo-1,3-dihydroimidazole-4-carbonyl)phenyl]isoindole-1,3-dione.
| Compound Name | 2-[4-(5-ethyl-2-oxo-1,3-dihydroimidazole-4-carbonyl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 10570568 |
| Molecular Formula | C20H15N3O4 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 2-[4-(5-ethyl-2-oxo-1,3-dihydroimidazole-4-carbonyl)phenyl]isoindole-1,3-dione |
| SMILES | CCc1[nH]c(=O)[nH]c1C(=O)c1ccc(N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C20H15N3O4/c1-2-15-16(22-20(27)21-15)17(24)11-7-9-12(10-8-11)23-18(25)13-5-3-4-6-14(13)19(23)26/h3-10H,2H2,1H3,(H2,21,22,27) |
| InChIKey | CILPJFPOJNSDME-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 103.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|