C30H34BrFN2O4 — CID 20516005
3-[2-fluoro-2-(4-phenylphenyl)propanoyl]oxypropyl 4-amino-3-bromo-5-(diethylaminomethyl)benzoate (PubChem CID 20516005) has the molecular formula C30H34BrFN2O4 and a molecular weight of 585.51 g/mol. Its IUPAC name is 3-[2-fluoro-2-(4-phenylphenyl)propanoyl]oxypropyl 4-amino-3-bromo-5-(diethylaminomethyl)benzoate.
| Compound Name | 3-[2-fluoro-2-(4-phenylphenyl)propanoyl]oxypropyl 4-amino-3-bromo-5-(diethylaminomethyl)benzoate |
|---|---|
| PubChem CID | 20516005 |
| Molecular Formula | C30H34BrFN2O4 |
| Molecular Weight | 585.51 g/mol |
| Exact Mass | 584.17 |
| IUPAC Name | 3-[2-fluoro-2-(4-phenylphenyl)propanoyl]oxypropyl 4-amino-3-bromo-5-(diethylaminomethyl)benzoate |
| SMILES | CCN(CC)Cc1cc(C(=O)OCCCOC(=O)C(C)(F)c2ccc(-c3ccccc3)cc2)cc(Br)c1N |
| InChI | InChI=1S/C30H34BrFN2O4/c1-4-34(5-2)20-24-18-23(19-26(31)27(24)33)28(35)37-16-9-17-38-29(36)30(3,32)25-14-12-22(13-15-25)21-10-7-6-8-11-21/h6-8,10-15,18-19H,4-5,9,16-17,20,33H2,1-3H3 |
| InChIKey | MKZKVBDAWSJFJL-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.51 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|