C29H32BrFN2O4 — CID 20516021
2-[2-fluoro-2-(4-phenylphenyl)propanoyl]oxyethyl 4-amino-3-bromo-5-(diethylaminomethyl)benzoate (PubChem CID 20516021) has the molecular formula C29H32BrFN2O4 and a molecular weight of 571.49 g/mol. Its IUPAC name is 2-[2-fluoro-2-(4-phenylphenyl)propanoyl]oxyethyl 4-amino-3-bromo-5-(diethylaminomethyl)benzoate.
| Compound Name | 2-[2-fluoro-2-(4-phenylphenyl)propanoyl]oxyethyl 4-amino-3-bromo-5-(diethylaminomethyl)benzoate |
|---|---|
| PubChem CID | 20516021 |
| Molecular Formula | C29H32BrFN2O4 |
| Molecular Weight | 571.49 g/mol |
| Exact Mass | 570.15 |
| IUPAC Name | 2-[2-fluoro-2-(4-phenylphenyl)propanoyl]oxyethyl 4-amino-3-bromo-5-(diethylaminomethyl)benzoate |
| SMILES | CCN(CC)Cc1cc(C(=O)OCCOC(=O)C(C)(F)c2ccc(-c3ccccc3)cc2)cc(Br)c1N |
| InChI | InChI=1S/C29H32BrFN2O4/c1-4-33(5-2)19-23-17-22(18-25(30)26(23)32)27(34)36-15-16-37-28(35)29(3,31)24-13-11-21(12-14-24)20-9-7-6-8-10-20/h6-14,17-18H,4-5,15-16,19,32H2,1-3H3 |
| InChIKey | TZOLHGGYZWBETE-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.49 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|