C16H21N2O3- — CID 2051651
3-oxo-3-[4-(2,4,6-trimethylphenyl)piperazin-1-yl]propanoate (PubChem CID 2051651) has the molecular formula C16H21N2O3- and a molecular weight of 289.36 g/mol. Its IUPAC name is 3-oxo-3-[4-(2,4,6-trimethylphenyl)piperazin-1-yl]propanoate.
| Compound Name | 3-oxo-3-[4-(2,4,6-trimethylphenyl)piperazin-1-yl]propanoate |
|---|---|
| PubChem CID | 2051651 |
| Molecular Formula | C16H21N2O3- |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 3-oxo-3-[4-(2,4,6-trimethylphenyl)piperazin-1-yl]propanoate |
| SMILES | Cc1cc(C)c(N2CCN(C(=O)CC(=O)[O-])CC2)c(C)c1 |
| InChI | InChI=1S/C16H22N2O3/c1-11-8-12(2)16(13(3)9-11)18-6-4-17(5-7-18)14(19)10-15(20)21/h8-9H,4-7,10H2,1-3H3,(H,20,21)/p-1 |
| InChIKey | CMSYFMIKTKYZPN-UHFFFAOYSA-M |
| XLogP | 0.40 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|