C8H10N2O2S — CID 20517178
N-methyl-N-[2-oxo-1-(1,3-thiazol-2-yl)ethyl]acetamide (PubChem CID 20517178) has the molecular formula C8H10N2O2S and a molecular weight of 198.25 g/mol. Its IUPAC name is N-methyl-N-[2-oxo-1-(1,3-thiazol-2-yl)ethyl]acetamide.
| Compound Name | N-methyl-N-[2-oxo-1-(1,3-thiazol-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 20517178 |
| Molecular Formula | C8H10N2O2S |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | N-methyl-N-[2-oxo-1-(1,3-thiazol-2-yl)ethyl]acetamide |
| SMILES | CC(=O)N(C)C(C=O)c1nccs1 |
| InChI | InChI=1S/C8H10N2O2S/c1-6(12)10(2)7(5-11)8-9-3-4-13-8/h3-5,7H,1-2H3 |
| InChIKey | LOPGATGVDVXUJE-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|