C10H16N2OS — CID 71910308
N-ethyl-N-[2-(1,3-thiazol-2-yl)ethyl]propanamide (PubChem CID 71910308) has the molecular formula C10H16N2OS and a molecular weight of 212.32 g/mol. Its IUPAC name is N-ethyl-N-[2-(1,3-thiazol-2-yl)ethyl]propanamide.
| Compound Name | N-ethyl-N-[2-(1,3-thiazol-2-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 71910308 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | N-ethyl-N-[2-(1,3-thiazol-2-yl)ethyl]propanamide |
| SMILES | CCC(=O)N(CC)CCc1nccs1 |
| InChI | InChI=1S/C10H16N2OS/c1-3-10(13)12(4-2)7-5-9-11-6-8-14-9/h6,8H,3-5,7H2,1-2H3 |
| InChIKey | BQXGCAVQYOBLJK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |