C16H25NO2 — CID 20517549
2-ethyl-2-(3-methoxyphenyl)-4,6,6-trimethylmorpholine (PubChem CID 20517549) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is 2-ethyl-2-(3-methoxyphenyl)-4,6,6-trimethylmorpholine.
| Compound Name | 2-ethyl-2-(3-methoxyphenyl)-4,6,6-trimethylmorpholine |
|---|---|
| PubChem CID | 20517549 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 2-ethyl-2-(3-methoxyphenyl)-4,6,6-trimethylmorpholine |
| SMILES | CCC1(c2cccc(OC)c2)CN(C)CC(C)(C)O1 |
| InChI | InChI=1S/C16H25NO2/c1-6-16(12-17(4)11-15(2,3)19-16)13-8-7-9-14(10-13)18-5/h7-10H,6,11-12H2,1-5H3 |
| InChIKey | HDAKSNJPDXMQPC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |