About (2S)-2-ethyl-2-(3-methoxyphenyl)-4-methyl-1,4-thiazinane 1-oxide;hydrochloride
(2S)-2-ethyl-2-(3-methoxyphenyl)-4-methyl-1,4-thiazinane 1-oxide;hydrochloride (PubChem CID 70508703) has the molecular formula C14H22ClNO2S
and a molecular weight of 303.86 g/mol. Its IUPAC name is (2S)-2-ethyl-2-(3-methoxyphenyl)-4-methyl-1,4-thiazinane 1-oxide;hydrochloride.
Molecular Properties
| Compound Name | (2S)-2-ethyl-2-(3-methoxyphenyl)-4-methyl-1,4-thiazinane 1-oxide;hydrochloride |
| PubChem CID | 70508703 |
| Molecular Formula | C14H22ClNO2S |
| Molecular Weight | 303.86 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | (2S)-2-ethyl-2-(3-methoxyphenyl)-4-methyl-1,4-thiazinane 1-oxide;hydrochloride |
| SMILES | CC[C@]1(c2cccc(OC)c2)CN(C)CCS1=O.Cl |
| InChI | InChI=1S/C14H21NO2S.ClH/c1-4-14(11-15(2)8-9-18(14)16)12-6-5-7-13(10-12)17-3;/h5-7,10H,4,8-9,11H2,1-3H3;1H/t14-,18?;/m1./s1 |
| InChIKey | MKXPFNDOBTZKJO-BSOSYTQUSA-N |
| XLogP | 2.42 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.86 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-ethyl-2-(3-methoxyphenyl)-4-methyl-1,4-thiazinane 1-oxide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-ethyl-2-(3-methoxyphenyl)-4-methyl-1,4-thiazinane 1-oxide;hydrochloride?
The IUPAC name of (2S)-2-ethyl-2-(3-methoxyphenyl)-4-methyl-1,4-thiazinane 1-oxide;hydrochloride (CID 70508703) is (2S)-2-ethyl-2-(3-methoxyphenyl)-4-methyl-1,4-thiazinane 1-oxide;hydrochloride.
What is the SMILES notation for (2S)-2-ethyl-2-(3-methoxyphenyl)-4-methyl-1,4-thiazinane 1-oxide;hydrochloride?
The canonical SMILES for (2S)-2-ethyl-2-(3-methoxyphenyl)-4-methyl-1,4-thiazinane 1-oxide;hydrochloride is CC[C@]1(c2cccc(OC)c2)CN(C)CCS1=O.Cl.
What is the InChIKey of (2S)-2-ethyl-2-(3-methoxyphenyl)-4-methyl-1,4-thiazinane 1-oxide;hydrochloride?
The InChIKey is MKXPFNDOBTZKJO-BSOSYTQUSA-N. The full InChI is InChI=1S/C14H21NO2S.ClH/c1-4-14(11-15(2)8-9-18(14)16)12-6-5-7-13(10-12)17-3;/h5-7,10H,4,8-9,11H2,1-3H3;1H/t14-,18?;/m1./s1.
What are the key properties of (2S)-2-ethyl-2-(3-methoxyphenyl)-4-methyl-1,4-thiazinane 1-oxide;hydrochloride?
(2S)-2-ethyl-2-(3-methoxyphenyl)-4-methyl-1,4-thiazinane 1-oxide;hydrochloride has a molecular weight of 303.86 g/mol, XLogP of 2.42, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-ethyl-2-(3-methoxyphenyl)-4-methyl-1,4-thiazinane 1-oxide;hydrochloride is sourced from PubChem (CID 70508703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).