C12H16NO3PS — CID 20520065
1-[2-cyanoethyl(phenyl)phosphanyl]propane-1-sulfonic acid (PubChem CID 20520065) has the molecular formula C12H16NO3PS and a molecular weight of 285.31 g/mol. Its IUPAC name is 1-[2-cyanoethyl(phenyl)phosphanyl]propane-1-sulfonic acid.
| Compound Name | 1-[2-cyanoethyl(phenyl)phosphanyl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 20520065 |
| Molecular Formula | C12H16NO3PS |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 1-[2-cyanoethyl(phenyl)phosphanyl]propane-1-sulfonic acid |
| SMILES | CCC(P(CCC#N)c1ccccc1)S(=O)(=O)O |
| InChI | InChI=1S/C12H16NO3PS/c1-2-12(18(14,15)16)17(10-6-9-13)11-7-4-3-5-8-11/h3-5,7-8,12H,2,6,10H2,1H3,(H,14,15,16) |
| InChIKey | OYQGFSXBEADXFQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|