C9H11F9O3 — CID 20520084
1,1,1,2,3,5,5,5-octafluoro-4-[fluoro(methoxy)methyl]-2,3-dimethoxypentane (PubChem CID 20520084) has the molecular formula C9H11F9O3 and a molecular weight of 338.17 g/mol. Its IUPAC name is 1,1,1,2,3,5,5,5-octafluoro-4-[fluoro(methoxy)methyl]-2,3-dimethoxypentane.
| Compound Name | 1,1,1,2,3,5,5,5-octafluoro-4-[fluoro(methoxy)methyl]-2,3-dimethoxypentane |
|---|---|
| PubChem CID | 20520084 |
| Molecular Formula | C9H11F9O3 |
| Molecular Weight | 338.17 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 1,1,1,2,3,5,5,5-octafluoro-4-[fluoro(methoxy)methyl]-2,3-dimethoxypentane |
| SMILES | COC(F)C(C(F)(F)F)C(F)(OC)C(F)(OC)C(F)(F)F |
| InChI | InChI=1S/C9H11F9O3/c1-19-5(10)4(7(12,13)14)6(11,20-2)8(15,21-3)9(16,17)18/h4-5H,1-3H3 |
| InChIKey | NKPRHDZQXFCGEZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.17 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |