C10H13F9O2 — CID 19761929
1,3-diethoxy-1,1,2,3,4,4,5,5,5-nonafluoro-2-methylpentane (PubChem CID 19761929) has the molecular formula C10H13F9O2 and a molecular weight of 336.19 g/mol. Its IUPAC name is 1,3-diethoxy-1,1,2,3,4,4,5,5,5-nonafluoro-2-methylpentane.
| Compound Name | 1,3-diethoxy-1,1,2,3,4,4,5,5,5-nonafluoro-2-methylpentane |
|---|---|
| PubChem CID | 19761929 |
| Molecular Formula | C10H13F9O2 |
| Molecular Weight | 336.19 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 1,3-diethoxy-1,1,2,3,4,4,5,5,5-nonafluoro-2-methylpentane |
| SMILES | CCOC(F)(F)C(C)(F)C(F)(OCC)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H13F9O2/c1-4-20-8(14,7(12,13)9(15,16)17)6(3,11)10(18,19)21-5-2/h4-5H2,1-3H3 |
| InChIKey | JAIISGWXIWIOKA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.19 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|