C8H9F9O2 — CID 19761955
1,1,1,2,2,3,4,5,5-nonafluoro-3,5-dimethoxy-4-methylpentane (PubChem CID 19761955) has the molecular formula C8H9F9O2 and a molecular weight of 308.14 g/mol. Its IUPAC name is 1,1,1,2,2,3,4,5,5-nonafluoro-3,5-dimethoxy-4-methylpentane.
| Compound Name | 1,1,1,2,2,3,4,5,5-nonafluoro-3,5-dimethoxy-4-methylpentane |
|---|---|
| PubChem CID | 19761955 |
| Molecular Formula | C8H9F9O2 |
| Molecular Weight | 308.14 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 1,1,1,2,2,3,4,5,5-nonafluoro-3,5-dimethoxy-4-methylpentane |
| SMILES | COC(F)(F)C(C)(F)C(F)(OC)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H9F9O2/c1-4(9,8(16,17)19-3)6(12,18-2)5(10,11)7(13,14)15/h1-3H3 |
| InChIKey | RCQXRVRBZSJDKJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.14 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|