C7H10F6O — CID 58419167
1,1,2,4,4,5-hexafluoro-1-methoxy-2-methylpentane (PubChem CID 58419167) has the molecular formula C7H10F6O and a molecular weight of 224.14 g/mol. Its IUPAC name is 1,1,2,4,4,5-hexafluoro-1-methoxy-2-methylpentane.
| Compound Name | 1,1,2,4,4,5-hexafluoro-1-methoxy-2-methylpentane |
|---|---|
| PubChem CID | 58419167 |
| Molecular Formula | C7H10F6O |
| Molecular Weight | 224.14 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 1,1,2,4,4,5-hexafluoro-1-methoxy-2-methylpentane |
| SMILES | COC(F)(F)C(C)(F)CC(F)(F)CF |
| InChI | InChI=1S/C7H10F6O/c1-5(9,7(12,13)14-2)3-6(10,11)4-8/h3-4H2,1-2H3 |
| InChIKey | VFLFKGITTZGHQV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.14 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |