C13H14F18O2 — CID 54199223
2-[difluoro(1,1,2-trifluoroethoxy)methyl]-1,1,1,4,5,5,5-heptafluoropentane;fluoromethane;1,1,2,2-tetrafluoro-1-(fluoromethoxy)propane (PubChem CID 54199223) has the molecular formula C13H14F18O2 and a molecular weight of 544.22 g/mol. Its IUPAC name is 2-[difluoro(1,1,2-trifluoroethoxy)methyl]-1,1,1,4,5,5,5-heptafluoropentane;fluoromethane;1,1,2,2-tetrafluoro-1-(fluoromethoxy)propane.
| Compound Name | 2-[difluoro(1,1,2-trifluoroethoxy)methyl]-1,1,1,4,5,5,5-heptafluoropentane;fluoromethane;1,1,2,2-tetrafluoro-1-(fluoromethoxy)propane |
|---|---|
| PubChem CID | 54199223 |
| Molecular Formula | C13H14F18O2 |
| Molecular Weight | 544.22 g/mol |
| Exact Mass | 544.07 |
| IUPAC Name | 2-[difluoro(1,1,2-trifluoroethoxy)methyl]-1,1,1,4,5,5,5-heptafluoropentane;fluoromethane;1,1,2,2-tetrafluoro-1-(fluoromethoxy)propane |
| SMILES | CC(F)(F)C(F)(F)OCF.CF.FCC(F)(F)OC(F)(F)C(CC(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H6F12O.C4H5F5O.CH3F/c9-2-5(11,12)21-8(19,20)3(6(13,14)15)1-4(10)7(16,17)18;1-3(6,7)4(8,9)10-2-5;1-2/h3-4H,1-2H2;2H2,1H3;1H3 |
| InChIKey | POAHWWRNIFPTCH-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.22 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|