C20H17N3O2S — CID 20521593
1-(6-ethoxy-11-methyl-12-phenyl-8-thia-3,4,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-5-yl)ethanone (PubChem CID 20521593) has the molecular formula C20H17N3O2S and a molecular weight of 363.44 g/mol. Its IUPAC name is 1-(6-ethoxy-11-methyl-12-phenyl-8-thia-3,4,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-5-yl)ethanone.
| Compound Name | 1-(6-ethoxy-11-methyl-12-phenyl-8-thia-3,4,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-5-yl)ethanone |
|---|---|
| PubChem CID | 20521593 |
| Molecular Formula | C20H17N3O2S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 1-(6-ethoxy-11-methyl-12-phenyl-8-thia-3,4,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-5-yl)ethanone |
| SMILES | CCOc1c(C(C)=O)nnc2c1sc1nc(C)c(-c3ccccc3)cc12 |
| InChI | InChI=1S/C20H17N3O2S/c1-4-25-18-16(12(3)24)22-23-17-15-10-14(13-8-6-5-7-9-13)11(2)21-20(15)26-19(17)18/h5-10H,4H2,1-3H3 |
| InChIKey | BNZQEWJMAMSJER-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |