C19H21BrN2O2S — CID 20525394
3-[2-(benzylamino)ethyl]-5-methyl-5-phenyl-1,3-thiazolidine-2,4-dione;hydrobromide (PubChem CID 20525394) has the molecular formula C19H21BrN2O2S and a molecular weight of 421.36 g/mol. Its IUPAC name is 3-[2-(benzylamino)ethyl]-5-methyl-5-phenyl-1,3-thiazolidine-2,4-dione;hydrobromide.
| Compound Name | 3-[2-(benzylamino)ethyl]-5-methyl-5-phenyl-1,3-thiazolidine-2,4-dione;hydrobromide |
|---|---|
| PubChem CID | 20525394 |
| Molecular Formula | C19H21BrN2O2S |
| Molecular Weight | 421.36 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | 3-[2-(benzylamino)ethyl]-5-methyl-5-phenyl-1,3-thiazolidine-2,4-dione;hydrobromide |
| SMILES | Br.CC1(c2ccccc2)SC(=O)N(CCNCc2ccccc2)C1=O |
| InChI | InChI=1S/C19H20N2O2S.BrH/c1-19(16-10-6-3-7-11-16)17(22)21(18(23)24-19)13-12-20-14-15-8-4-2-5-9-15;/h2-11,20H,12-14H2,1H3;1H |
| InChIKey | FUUIMUIRMLPSIQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|