C23H21NO3S2 — CID 20530108
N-(2-methoxyphenyl)-3-oxo-2,2-bis(phenylsulfanyl)butanamide (PubChem CID 20530108) has the molecular formula C23H21NO3S2 and a molecular weight of 423.56 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-3-oxo-2,2-bis(phenylsulfanyl)butanamide.
| Compound Name | N-(2-methoxyphenyl)-3-oxo-2,2-bis(phenylsulfanyl)butanamide |
|---|---|
| PubChem CID | 20530108 |
| Molecular Formula | C23H21NO3S2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | N-(2-methoxyphenyl)-3-oxo-2,2-bis(phenylsulfanyl)butanamide |
| SMILES | COc1ccccc1NC(=O)C(Sc1ccccc1)(Sc1ccccc1)C(C)=O |
| InChI | InChI=1S/C23H21NO3S2/c1-17(25)23(28-18-11-5-3-6-12-18,29-19-13-7-4-8-14-19)22(26)24-20-15-9-10-16-21(20)27-2/h3-16H,1-2H3,(H,24,26) |
| InChIKey | DLVZONAJTYYWBL-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|