C15H25ClO — CID 20531509
4-(5-chloro-2,2,3-trimethyl-6-methylidenecyclohexyl)-3-methylbutan-2-one (PubChem CID 20531509) has the molecular formula C15H25ClO and a molecular weight of 256.82 g/mol. Its IUPAC name is 4-(5-chloro-2,2,3-trimethyl-6-methylidenecyclohexyl)-3-methylbutan-2-one.
| Compound Name | 4-(5-chloro-2,2,3-trimethyl-6-methylidenecyclohexyl)-3-methylbutan-2-one |
|---|---|
| PubChem CID | 20531509 |
| Molecular Formula | C15H25ClO |
| Molecular Weight | 256.82 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 4-(5-chloro-2,2,3-trimethyl-6-methylidenecyclohexyl)-3-methylbutan-2-one |
| SMILES | C=C1C(Cl)CC(C)C(C)(C)C1CC(C)C(C)=O |
| InChI | InChI=1S/C15H25ClO/c1-9(12(4)17)7-13-11(3)14(16)8-10(2)15(13,5)6/h9-10,13-14H,3,7-8H2,1-2,4-6H3 |
| InChIKey | CELHRIAHLWJSPK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.82 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|