C16H27ClO — CID 20531510
1-(5-chloro-2,2,3-trimethyl-6-methylidenecyclohexyl)-2-methylpentan-3-one (PubChem CID 20531510) has the molecular formula C16H27ClO and a molecular weight of 270.84 g/mol. Its IUPAC name is 1-(5-chloro-2,2,3-trimethyl-6-methylidenecyclohexyl)-2-methylpentan-3-one.
| Compound Name | 1-(5-chloro-2,2,3-trimethyl-6-methylidenecyclohexyl)-2-methylpentan-3-one |
|---|---|
| PubChem CID | 20531510 |
| Molecular Formula | C16H27ClO |
| Molecular Weight | 270.84 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 1-(5-chloro-2,2,3-trimethyl-6-methylidenecyclohexyl)-2-methylpentan-3-one |
| SMILES | C=C1C(Cl)CC(C)C(C)(C)C1CC(C)C(=O)CC |
| InChI | InChI=1S/C16H27ClO/c1-7-15(18)10(2)8-13-12(4)14(17)9-11(3)16(13,5)6/h10-11,13-14H,4,7-9H2,1-3,5-6H3 |
| InChIKey | KEDKHZNKZFXUCD-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.84 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|