C12H27NO3 — CID 162682105
methoxymethane;3-(2-methyl-3-oxopentyl)pyrrolidin-2-one;molecular hydrogen (PubChem CID 162682105) has the molecular formula C12H27NO3 and a molecular weight of 233.35 g/mol. Its IUPAC name is methoxymethane;3-(2-methyl-3-oxopentyl)pyrrolidin-2-one;molecular hydrogen.
| Compound Name | methoxymethane;3-(2-methyl-3-oxopentyl)pyrrolidin-2-one;molecular hydrogen |
|---|---|
| PubChem CID | 162682105 |
| Molecular Formula | C12H27NO3 |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.20 |
| IUPAC Name | methoxymethane;3-(2-methyl-3-oxopentyl)pyrrolidin-2-one;molecular hydrogen |
| SMILES | CCC(=O)C(C)CC1CCNC1=O.COC.[H][H].[H][H] |
| InChI | InChI=1S/C10H17NO2.C2H6O.2H2/c1-3-9(12)7(2)6-8-4-5-11-10(8)13;1-3-2;;/h7-8H,3-6H2,1-2H3,(H,11,13);1-2H3;2*1H |
| InChIKey | RGFZBPXTHLOWDV-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |