C15H25ClN2O4 — CID 167338959
[(3S)-3-(chloroamino)-2-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butyl] heptanoate (PubChem CID 167338959) has the molecular formula C15H25ClN2O4 and a molecular weight of 332.83 g/mol. Its IUPAC name is [(3S)-3-(chloroamino)-2-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butyl] heptanoate.
| Compound Name | [(3S)-3-(chloroamino)-2-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butyl] heptanoate |
|---|---|
| PubChem CID | 167338959 |
| Molecular Formula | C15H25ClN2O4 |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | [(3S)-3-(chloroamino)-2-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butyl] heptanoate |
| SMILES | CCCCCCC(=O)OCC(=O)[C@H](C[C@@H]1CCNC1=O)NCl |
| InChI | InChI=1S/C15H25ClN2O4/c1-2-3-4-5-6-14(20)22-10-13(19)12(18-16)9-11-7-8-17-15(11)21/h11-12,18H,2-10H2,1H3,(H,17,21)/t11-,12-/m0/s1 |
| InChIKey | BVPCTOVAONVGJU-RYUDHWBXSA-N |
| XLogP | 1.71 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|