C21H32ClNO2 — CID 20533457
(2-butyl-7-phenyl-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-yl) acetate;hydrochloride (PubChem CID 20533457) has the molecular formula C21H32ClNO2 and a molecular weight of 365.95 g/mol. Its IUPAC name is (2-butyl-7-phenyl-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-yl) acetate;hydrochloride.
| Compound Name | (2-butyl-7-phenyl-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-yl) acetate;hydrochloride |
|---|---|
| PubChem CID | 20533457 |
| Molecular Formula | C21H32ClNO2 |
| Molecular Weight | 365.95 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | (2-butyl-7-phenyl-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-yl) acetate;hydrochloride |
| SMILES | CCCCC1(OC(C)=O)CCN2CC(c3ccccc3)CCC2C1.Cl |
| InChI | InChI=1S/C21H31NO2.ClH/c1-3-4-12-21(24-17(2)23)13-14-22-16-19(10-11-20(22)15-21)18-8-6-5-7-9-18;/h5-9,19-20H,3-4,10-16H2,1-2H3;1H |
| InChIKey | LZLBXRGFFCZFJX-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.95 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |