C19H29N — CID 54337398
2-butyl-7-phenyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine (PubChem CID 54337398) has the molecular formula C19H29N and a molecular weight of 271.45 g/mol. Its IUPAC name is 2-butyl-7-phenyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine.
| Compound Name | 2-butyl-7-phenyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine |
|---|---|
| PubChem CID | 54337398 |
| Molecular Formula | C19H29N |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | 2-butyl-7-phenyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine |
| SMILES | CCCCC1CCN2CC(c3ccccc3)CCC2C1 |
| InChI | InChI=1S/C19H29N/c1-2-3-7-16-12-13-20-15-18(10-11-19(20)14-16)17-8-5-4-6-9-17/h4-6,8-9,16,18-19H,2-3,7,10-15H2,1H3 |
| InChIKey | OQZHEWHHEBEKCI-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |