C27H33NO4 — CID 20539745
phenyl 2-[(7-decyl-3-oxo-1,2-dihydroinden-4-yl)amino]-2-oxoacetate (PubChem CID 20539745) has the molecular formula C27H33NO4 and a molecular weight of 435.56 g/mol. Its IUPAC name is phenyl 2-[(7-decyl-3-oxo-1,2-dihydroinden-4-yl)amino]-2-oxoacetate.
| Compound Name | phenyl 2-[(7-decyl-3-oxo-1,2-dihydroinden-4-yl)amino]-2-oxoacetate |
|---|---|
| PubChem CID | 20539745 |
| Molecular Formula | C27H33NO4 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | phenyl 2-[(7-decyl-3-oxo-1,2-dihydroinden-4-yl)amino]-2-oxoacetate |
| SMILES | CCCCCCCCCCc1ccc(NC(=O)C(=O)Oc2ccccc2)c2c1CCC2=O |
| InChI | InChI=1S/C27H33NO4/c1-2-3-4-5-6-7-8-10-13-20-16-18-23(25-22(20)17-19-24(25)29)28-26(30)27(31)32-21-14-11-9-12-15-21/h9,11-12,14-16,18H,2-8,10,13,17,19H2,1H3,(H,28,30) |
| InChIKey | FABRMWWGBLGWDN-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|