C12H13NO3S — CID 20540317
S-[2-(2-acetamido-2-oxoethyl)phenyl] ethanethioate (PubChem CID 20540317) has the molecular formula C12H13NO3S and a molecular weight of 251.31 g/mol. Its IUPAC name is S-[2-(2-acetamido-2-oxoethyl)phenyl] ethanethioate.
| Compound Name | S-[2-(2-acetamido-2-oxoethyl)phenyl] ethanethioate |
|---|---|
| PubChem CID | 20540317 |
| Molecular Formula | C12H13NO3S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | S-[2-(2-acetamido-2-oxoethyl)phenyl] ethanethioate |
| SMILES | CC(=O)NC(=O)Cc1ccccc1SC(C)=O |
| InChI | InChI=1S/C12H13NO3S/c1-8(14)13-12(16)7-10-5-3-4-6-11(10)17-9(2)15/h3-6H,7H2,1-2H3,(H,13,14,16) |
| InChIKey | JLSGVHRDROCINU-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|