C23H16Cl2N2O2 — CID 20542736
2-[1-(2,4-dichlorophenyl)-3,5-diphenylpyrazol-4-yl]acetic acid (PubChem CID 20542736) has the molecular formula C23H16Cl2N2O2 and a molecular weight of 423.30 g/mol. Its IUPAC name is 2-[1-(2,4-dichlorophenyl)-3,5-diphenylpyrazol-4-yl]acetic acid.
| Compound Name | 2-[1-(2,4-dichlorophenyl)-3,5-diphenylpyrazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 20542736 |
| Molecular Formula | C23H16Cl2N2O2 |
| Molecular Weight | 423.30 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | 2-[1-(2,4-dichlorophenyl)-3,5-diphenylpyrazol-4-yl]acetic acid |
| SMILES | O=C(O)Cc1c(-c2ccccc2)nn(-c2ccc(Cl)cc2Cl)c1-c1ccccc1 |
| InChI | InChI=1S/C23H16Cl2N2O2/c24-17-11-12-20(19(25)13-17)27-23(16-9-5-2-6-10-16)18(14-21(28)29)22(26-27)15-7-3-1-4-8-15/h1-13H,14H2,(H,28,29) |
| InChIKey | DYWHKAGQNBZSKC-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.30 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |