About [1-(2,4-dichlorophenyl)-4-ethyl-5-(4-methylphenyl)pyrazol-3-yl] ethaneperoxoate
[1-(2,4-dichlorophenyl)-4-ethyl-5-(4-methylphenyl)pyrazol-3-yl] ethaneperoxoate (PubChem CID 175736151) has the molecular formula C20H18Cl2N2O3
and a molecular weight of 405.28 g/mol. Its IUPAC name is [1-(2,4-dichlorophenyl)-4-ethyl-5-(4-methylphenyl)pyrazol-3-yl] ethaneperoxoate.
Molecular Properties
| Compound Name | [1-(2,4-dichlorophenyl)-4-ethyl-5-(4-methylphenyl)pyrazol-3-yl] ethaneperoxoate |
| PubChem CID | 175736151 |
| Molecular Formula | C20H18Cl2N2O3 |
| Molecular Weight | 405.28 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | [1-(2,4-dichlorophenyl)-4-ethyl-5-(4-methylphenyl)pyrazol-3-yl] ethaneperoxoate |
| SMILES | CCc1c(OOC(C)=O)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(C)cc1 |
| InChI | InChI=1S/C20H18Cl2N2O3/c1-4-16-19(14-7-5-12(2)6-8-14)24(23-20(16)27-26-13(3)25)18-10-9-15(21)11-17(18)22/h5-11H,4H2,1-3H3 |
| InChIKey | PXXWJKVLBKCVMG-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.28 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze [1-(2,4-dichlorophenyl)-4-ethyl-5-(4-methylphenyl)pyrazol-3-yl] ethaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,4-dichlorophenyl)-4-ethyl-5-(4-methylphenyl)pyrazol-3-yl] ethaneperoxoate?
The IUPAC name of [1-(2,4-dichlorophenyl)-4-ethyl-5-(4-methylphenyl)pyrazol-3-yl] ethaneperoxoate (CID 175736151) is [1-(2,4-dichlorophenyl)-4-ethyl-5-(4-methylphenyl)pyrazol-3-yl] ethaneperoxoate.
What is the SMILES notation for [1-(2,4-dichlorophenyl)-4-ethyl-5-(4-methylphenyl)pyrazol-3-yl] ethaneperoxoate?
The canonical SMILES for [1-(2,4-dichlorophenyl)-4-ethyl-5-(4-methylphenyl)pyrazol-3-yl] ethaneperoxoate is CCc1c(OOC(C)=O)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(C)cc1.
What is the InChIKey of [1-(2,4-dichlorophenyl)-4-ethyl-5-(4-methylphenyl)pyrazol-3-yl] ethaneperoxoate?
The InChIKey is PXXWJKVLBKCVMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18Cl2N2O3/c1-4-16-19(14-7-5-12(2)6-8-14)24(23-20(16)27-26-13(3)25)18-10-9-15(21)11-17(18)22/h5-11H,4H2,1-3H3.
What are the key properties of [1-(2,4-dichlorophenyl)-4-ethyl-5-(4-methylphenyl)pyrazol-3-yl] ethaneperoxoate?
[1-(2,4-dichlorophenyl)-4-ethyl-5-(4-methylphenyl)pyrazol-3-yl] ethaneperoxoate has a molecular weight of 405.28 g/mol, XLogP of 5.57, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,4-dichlorophenyl)-4-ethyl-5-(4-methylphenyl)pyrazol-3-yl] ethaneperoxoate is sourced from PubChem (CID 175736151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).