C25H20Cl2N2O4 — CID 175736161
[1-(2,4-dichlorophenyl)-4-ethyl-5-(4-phenoxyphenyl)pyrazol-3-yl] ethaneperoxoate (PubChem CID 175736161) has the molecular formula C25H20Cl2N2O4 and a molecular weight of 483.35 g/mol. Its IUPAC name is [1-(2,4-dichlorophenyl)-4-ethyl-5-(4-phenoxyphenyl)pyrazol-3-yl] ethaneperoxoate.
| Compound Name | [1-(2,4-dichlorophenyl)-4-ethyl-5-(4-phenoxyphenyl)pyrazol-3-yl] ethaneperoxoate |
|---|---|
| PubChem CID | 175736161 |
| Molecular Formula | C25H20Cl2N2O4 |
| Molecular Weight | 483.35 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | [1-(2,4-dichlorophenyl)-4-ethyl-5-(4-phenoxyphenyl)pyrazol-3-yl] ethaneperoxoate |
| SMILES | CCc1c(OOC(C)=O)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C25H20Cl2N2O4/c1-3-21-24(17-9-12-20(13-10-17)31-19-7-5-4-6-8-19)29(28-25(21)33-32-16(2)30)23-14-11-18(26)15-22(23)27/h4-15H,3H2,1-2H3 |
| InChIKey | PATMEPAWRRAAFU-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.35 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|