C23H25BrCl2N2O3Si — CID 69238248
4-(bromomethyl)-5-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-1-(2,4-dichlorophenyl)pyrazole-3-carboxylic acid (PubChem CID 69238248) has the molecular formula C23H25BrCl2N2O3Si and a molecular weight of 556.36 g/mol. Its IUPAC name is 4-(bromomethyl)-5-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-1-(2,4-dichlorophenyl)pyrazole-3-carboxylic acid.
| Compound Name | 4-(bromomethyl)-5-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-1-(2,4-dichlorophenyl)pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 69238248 |
| Molecular Formula | C23H25BrCl2N2O3Si |
| Molecular Weight | 556.36 g/mol |
| Exact Mass | 554.02 |
| IUPAC Name | 4-(bromomethyl)-5-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-1-(2,4-dichlorophenyl)pyrazole-3-carboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(-c2c(CBr)c(C(=O)O)nn2-c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C23H25BrCl2N2O3Si/c1-23(2,3)32(4,5)31-16-9-6-14(7-10-16)21-17(13-24)20(22(29)30)27-28(21)19-11-8-15(25)12-18(19)26/h6-12H,13H2,1-5H3,(H,29,30) |
| InChIKey | QTLMQDZRNRHKPO-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.36 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|