C22H24Cl3N3O2Si — CID 86567497
5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-(hydroxymethyl)-N-(2-trimethylsilylethyl)pyrazole-3-carboxamide (PubChem CID 86567497) has the molecular formula C22H24Cl3N3O2Si and a molecular weight of 496.90 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-(hydroxymethyl)-N-(2-trimethylsilylethyl)pyrazole-3-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-(hydroxymethyl)-N-(2-trimethylsilylethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 86567497 |
| Molecular Formula | C22H24Cl3N3O2Si |
| Molecular Weight | 496.90 g/mol |
| Exact Mass | 495.07 |
| IUPAC Name | 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-(hydroxymethyl)-N-(2-trimethylsilylethyl)pyrazole-3-carboxamide |
| SMILES | C[Si](C)(C)CCNC(=O)c1nn(-c2ccc(Cl)cc2Cl)c(-c2ccc(Cl)cc2)c1CO |
| InChI | InChI=1S/C22H24Cl3N3O2Si/c1-31(2,3)11-10-26-22(30)20-17(13-29)21(14-4-6-15(23)7-5-14)28(27-20)19-9-8-16(24)12-18(19)25/h4-9,12,29H,10-11,13H2,1-3H3,(H,26,30) |
| InChIKey | PMNUXICROGEGOC-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.90 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|