C11H25N3 — CID 20545797
4-(3-aminopropyl)oct-4-ene-1,8-diamine (PubChem CID 20545797) has the molecular formula C11H25N3 and a molecular weight of 199.34 g/mol. Its IUPAC name is 4-(3-aminopropyl)oct-4-ene-1,8-diamine.
| Compound Name | 4-(3-aminopropyl)oct-4-ene-1,8-diamine |
|---|---|
| PubChem CID | 20545797 |
| Molecular Formula | C11H25N3 |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.20 |
| IUPAC Name | 4-(3-aminopropyl)oct-4-ene-1,8-diamine |
| SMILES | NCCCC=C(CCCN)CCCN |
| InChI | InChI=1S/C11H25N3/c12-8-2-1-5-11(6-3-9-13)7-4-10-14/h5H,1-4,6-10,12-14H2 |
| InChIKey | SCNTZRQMTVPZJJ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|