C39H69N9O6 — CID 20550397
N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-2-[2,4,6-trioxo-3,5-bis[2-oxo-2-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]ethyl]-1,3,5-triazinan-1-yl]acetamide (PubChem CID 20550397) has the molecular formula C39H69N9O6 and a molecular weight of 760.04 g/mol. Its IUPAC name is N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-2-[2,4,6-trioxo-3,5-bis[2-oxo-2-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]ethyl]-1,3,5-triazinan-1-yl]acetamide.
| Compound Name | N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-2-[2,4,6-trioxo-3,5-bis[2-oxo-2-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]ethyl]-1,3,5-triazinan-1-yl]acetamide |
|---|---|
| PubChem CID | 20550397 |
| Molecular Formula | C39H69N9O6 |
| Molecular Weight | 760.04 g/mol |
| Exact Mass | 759.54 |
| IUPAC Name | N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-2-[2,4,6-trioxo-3,5-bis[2-oxo-2-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]ethyl]-1,3,5-triazinan-1-yl]acetamide |
| SMILES | CN1C(C)(C)CC(NC(=O)Cn2c(=O)n(CC(=O)NC3CC(C)(C)N(C)C(C)(C)C3)c(=O)n(CC(=O)NC3CC(C)(C)N(C)C(C)(C)C3)c2=O)CC1(C)C |
| InChI | InChI=1S/C39H69N9O6/c1-34(2)16-25(17-35(3,4)43(34)13)40-28(49)22-46-31(52)47(23-29(50)41-26-18-36(5,6)44(14)37(7,8)19-26)33(54)48(32(46)53)24-30(51)42-27-20-38(9,10)45(15)39(11,12)21-27/h25-27H,16-24H2,1-15H3,(H,40,49)(H,41,50)(H,42,51) |
| InChIKey | YEXAOZGTDJPRDO-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 163.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.04 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |