C16H17FO4 — CID 20550484
ethyl 3-ethyl-6-(4-fluorophenyl)-4-oxo-2,3-dihydropyran-5-carboxylate (PubChem CID 20550484) has the molecular formula C16H17FO4 and a molecular weight of 292.31 g/mol. Its IUPAC name is ethyl 3-ethyl-6-(4-fluorophenyl)-4-oxo-2,3-dihydropyran-5-carboxylate.
| Compound Name | ethyl 3-ethyl-6-(4-fluorophenyl)-4-oxo-2,3-dihydropyran-5-carboxylate |
|---|---|
| PubChem CID | 20550484 |
| Molecular Formula | C16H17FO4 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | ethyl 3-ethyl-6-(4-fluorophenyl)-4-oxo-2,3-dihydropyran-5-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccc(F)cc2)OCC(CC)C1=O |
| InChI | InChI=1S/C16H17FO4/c1-3-10-9-21-15(11-5-7-12(17)8-6-11)13(14(10)18)16(19)20-4-2/h5-8,10H,3-4,9H2,1-2H3 |
| InChIKey | UMNDIKBWTONSNS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|