C12H17NO4S2 — CID 20554222
7-(2-methyl-3-sulfanylpropanoyl)-4-oxo-1-thia-7-azaspiro[4.4]nonane-8-carboxylic acid (PubChem CID 20554222) has the molecular formula C12H17NO4S2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 7-(2-methyl-3-sulfanylpropanoyl)-4-oxo-1-thia-7-azaspiro[4.4]nonane-8-carboxylic acid.
| Compound Name | 7-(2-methyl-3-sulfanylpropanoyl)-4-oxo-1-thia-7-azaspiro[4.4]nonane-8-carboxylic acid |
|---|---|
| PubChem CID | 20554222 |
| Molecular Formula | C12H17NO4S2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 7-(2-methyl-3-sulfanylpropanoyl)-4-oxo-1-thia-7-azaspiro[4.4]nonane-8-carboxylic acid |
| SMILES | CC(CS)C(=O)N1CC2(CC1C(=O)O)SCCC2=O |
| InChI | InChI=1S/C12H17NO4S2/c1-7(5-18)10(15)13-6-12(4-8(13)11(16)17)9(14)2-3-19-12/h7-8,18H,2-6H2,1H3,(H,16,17) |
| InChIKey | DLTGXRSWCLFDNT-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|