C23H21ClN4O2 — CID 20554384
6-butyl-11-(2-chloroacetyl)-2-phenylpyrimido[5,4-c][1,5]benzodiazepin-5-one (PubChem CID 20554384) has the molecular formula C23H21ClN4O2 and a molecular weight of 420.90 g/mol. Its IUPAC name is 6-butyl-11-(2-chloroacetyl)-2-phenylpyrimido[5,4-c][1,5]benzodiazepin-5-one.
| Compound Name | 6-butyl-11-(2-chloroacetyl)-2-phenylpyrimido[5,4-c][1,5]benzodiazepin-5-one |
|---|---|
| PubChem CID | 20554384 |
| Molecular Formula | C23H21ClN4O2 |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 6-butyl-11-(2-chloroacetyl)-2-phenylpyrimido[5,4-c][1,5]benzodiazepin-5-one |
| SMILES | CCCCN1C(=O)c2cnc(-c3ccccc3)nc2N(C(=O)CCl)c2ccccc21 |
| InChI | InChI=1S/C23H21ClN4O2/c1-2-3-13-27-18-11-7-8-12-19(18)28(20(29)14-24)22-17(23(27)30)15-25-21(26-22)16-9-5-4-6-10-16/h4-12,15H,2-3,13-14H2,1H3 |
| InChIKey | ONQVVGDRVMONBV-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|