C22H19NO5 — CID 20555321
2-[2-(6-methyl-2-pyridinyl)cyclopropyl]-4-oxo-3-prop-2-enoxychromene-6-carboxylic acid (PubChem CID 20555321) has the molecular formula C22H19NO5 and a molecular weight of 377.40 g/mol. Its IUPAC name is 2-[2-(6-methyl-2-pyridinyl)cyclopropyl]-4-oxo-3-prop-2-enoxychromene-6-carboxylic acid.
| Compound Name | 2-[2-(6-methyl-2-pyridinyl)cyclopropyl]-4-oxo-3-prop-2-enoxychromene-6-carboxylic acid |
|---|---|
| PubChem CID | 20555321 |
| Molecular Formula | C22H19NO5 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 2-[2-(6-methyl-2-pyridinyl)cyclopropyl]-4-oxo-3-prop-2-enoxychromene-6-carboxylic acid |
| SMILES | C=CCOc1c(C2CC2c2cccc(C)n2)oc2ccc(C(=O)O)cc2c1=O |
| InChI | InChI=1S/C22H19NO5/c1-3-9-27-21-19(24)16-10-13(22(25)26)7-8-18(16)28-20(21)15-11-14(15)17-6-4-5-12(2)23-17/h3-8,10,14-15H,1,9,11H2,2H3,(H,25,26) |
| InChIKey | YVXOQBDOYAWDQL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|