About 3-ethyl-2-[(1R,2R)-2-(6-methyl-2-pyridinyl)cyclopropyl]-4-oxochromene-6-carboxylic acid
3-ethyl-2-[(1R,2R)-2-(6-methyl-2-pyridinyl)cyclopropyl]-4-oxochromene-6-carboxylic acid (PubChem CID 22818876) has the molecular formula C21H19NO4
and a molecular weight of 349.39 g/mol. Its IUPAC name is 3-ethyl-2-[(1R,2R)-2-(6-methyl-2-pyridinyl)cyclopropyl]-4-oxochromene-6-carboxylic acid.
Molecular Properties
| Compound Name | 3-ethyl-2-[(1R,2R)-2-(6-methyl-2-pyridinyl)cyclopropyl]-4-oxochromene-6-carboxylic acid |
| PubChem CID | 22818876 |
| Molecular Formula | C21H19NO4 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 3-ethyl-2-[(1R,2R)-2-(6-methyl-2-pyridinyl)cyclopropyl]-4-oxochromene-6-carboxylic acid |
| SMILES | CCc1c([C@@H]2C[C@H]2c2cccc(C)n2)oc2ccc(C(=O)O)cc2c1=O |
| InChI | InChI=1S/C21H19NO4/c1-3-13-19(23)16-9-12(21(24)25)7-8-18(16)26-20(13)15-10-14(15)17-6-4-5-11(2)22-17/h4-9,14-15H,3,10H2,1-2H3,(H,24,25)/t14-,15-/m1/s1 |
| InChIKey | CSWSXQZOMFHVFV-HUUCEWRRSA-N |
| XLogP | 4.03 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-ethyl-2-[(1R,2R)-2-(6-methyl-2-pyridinyl)cyclopropyl]-4-oxochromene-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2-[(1R,2R)-2-(6-methyl-2-pyridinyl)cyclopropyl]-4-oxochromene-6-carboxylic acid?
The IUPAC name of 3-ethyl-2-[(1R,2R)-2-(6-methyl-2-pyridinyl)cyclopropyl]-4-oxochromene-6-carboxylic acid (CID 22818876) is 3-ethyl-2-[(1R,2R)-2-(6-methyl-2-pyridinyl)cyclopropyl]-4-oxochromene-6-carboxylic acid.
What is the SMILES notation for 3-ethyl-2-[(1R,2R)-2-(6-methyl-2-pyridinyl)cyclopropyl]-4-oxochromene-6-carboxylic acid?
The canonical SMILES for 3-ethyl-2-[(1R,2R)-2-(6-methyl-2-pyridinyl)cyclopropyl]-4-oxochromene-6-carboxylic acid is CCc1c([C@@H]2C[C@H]2c2cccc(C)n2)oc2ccc(C(=O)O)cc2c1=O.
What is the InChIKey of 3-ethyl-2-[(1R,2R)-2-(6-methyl-2-pyridinyl)cyclopropyl]-4-oxochromene-6-carboxylic acid?
The InChIKey is CSWSXQZOMFHVFV-HUUCEWRRSA-N. The full InChI is InChI=1S/C21H19NO4/c1-3-13-19(23)16-9-12(21(24)25)7-8-18(16)26-20(13)15-10-14(15)17-6-4-5-11(2)22-17/h4-9,14-15H,3,10H2,1-2H3,(H,24,25)/t14-,15-/m1/s1.
What are the key properties of 3-ethyl-2-[(1R,2R)-2-(6-methyl-2-pyridinyl)cyclopropyl]-4-oxochromene-6-carboxylic acid?
3-ethyl-2-[(1R,2R)-2-(6-methyl-2-pyridinyl)cyclopropyl]-4-oxochromene-6-carboxylic acid has a molecular weight of 349.39 g/mol, XLogP of 4.03, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2-[(1R,2R)-2-(6-methyl-2-pyridinyl)cyclopropyl]-4-oxochromene-6-carboxylic acid is sourced from PubChem (CID 22818876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).