C27H31NO5 — CID 21313886
2-(diethylamino)ethyl 3-ethoxy-4-oxo-2-(2-phenylcyclopropyl)chromene-6-carboxylate (PubChem CID 21313886) has the molecular formula C27H31NO5 and a molecular weight of 449.55 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 3-ethoxy-4-oxo-2-(2-phenylcyclopropyl)chromene-6-carboxylate.
| Compound Name | 2-(diethylamino)ethyl 3-ethoxy-4-oxo-2-(2-phenylcyclopropyl)chromene-6-carboxylate |
|---|---|
| PubChem CID | 21313886 |
| Molecular Formula | C27H31NO5 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 2-(diethylamino)ethyl 3-ethoxy-4-oxo-2-(2-phenylcyclopropyl)chromene-6-carboxylate |
| SMILES | CCOc1c(C2CC2c2ccccc2)oc2ccc(C(=O)OCCN(CC)CC)cc2c1=O |
| InChI | InChI=1S/C27H31NO5/c1-4-28(5-2)14-15-32-27(30)19-12-13-23-22(16-19)24(29)26(31-6-3)25(33-23)21-17-20(21)18-10-8-7-9-11-18/h7-13,16,20-21H,4-6,14-15,17H2,1-3H3 |
| InChIKey | ZGUCDEFHYGLNNZ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |