C22H31Cl2N3O3 — CID 20557062
N'-(2-hydroxy-3-morpholin-4-ylpropoxy)-3,3-diphenylpropanimidamide;dihydrochloride (PubChem CID 20557062) has the molecular formula C22H31Cl2N3O3 and a molecular weight of 456.41 g/mol. Its IUPAC name is N'-(2-hydroxy-3-morpholin-4-ylpropoxy)-3,3-diphenylpropanimidamide;dihydrochloride.
| Compound Name | N'-(2-hydroxy-3-morpholin-4-ylpropoxy)-3,3-diphenylpropanimidamide;dihydrochloride |
|---|---|
| PubChem CID | 20557062 |
| Molecular Formula | C22H31Cl2N3O3 |
| Molecular Weight | 456.41 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | N'-(2-hydroxy-3-morpholin-4-ylpropoxy)-3,3-diphenylpropanimidamide;dihydrochloride |
| SMILES | Cl.Cl.N/C(CC(c1ccccc1)c1ccccc1)=N\OCC(O)CN1CCOCC1 |
| InChI | InChI=1S/C22H29N3O3.2ClH/c23-22(24-28-17-20(26)16-25-11-13-27-14-12-25)15-21(18-7-3-1-4-8-18)19-9-5-2-6-10-19;;/h1-10,20-21,26H,11-17H2,(H2,23,24);2*1H |
| InChIKey | AMUZKFRKFMSSGC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|