C15H22ClN3O3 — CID 13207781
2-(4-chlorophenyl)-N'-(2-hydroxy-3-morpholin-4-ylpropoxy)ethanimidamide (PubChem CID 13207781) has the molecular formula C15H22ClN3O3 and a molecular weight of 327.81 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N'-(2-hydroxy-3-morpholin-4-ylpropoxy)ethanimidamide.
| Compound Name | 2-(4-chlorophenyl)-N'-(2-hydroxy-3-morpholin-4-ylpropoxy)ethanimidamide |
|---|---|
| PubChem CID | 13207781 |
| Molecular Formula | C15H22ClN3O3 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 2-(4-chlorophenyl)-N'-(2-hydroxy-3-morpholin-4-ylpropoxy)ethanimidamide |
| SMILES | N/C(Cc1ccc(Cl)cc1)=N\OCC(O)CN1CCOCC1 |
| InChI | InChI=1S/C15H22ClN3O3/c16-13-3-1-12(2-4-13)9-15(17)18-22-11-14(20)10-19-5-7-21-8-6-19/h1-4,14,20H,5-11H2,(H2,17,18) |
| InChIKey | WNFFFEWULXGKGC-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|